C15H28O3 — CID 19809722
2-[1-(3,3-dimethylcyclopentyl)ethoxy]propyl propanoate (PubChem CID 19809722) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[1-(3,3-dimethylcyclopentyl)ethoxy]propyl propanoate.
| Compound Name | 2-[1-(3,3-dimethylcyclopentyl)ethoxy]propyl propanoate |
|---|---|
| PubChem CID | 19809722 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-[1-(3,3-dimethylcyclopentyl)ethoxy]propyl propanoate |
| SMILES | CCC(=O)OCC(C)OC(C)C1CCC(C)(C)C1 |
| InChI | InChI=1S/C15H28O3/c1-6-14(16)17-10-11(2)18-12(3)13-7-8-15(4,5)9-13/h11-13H,6-10H2,1-5H3 |
| InChIKey | LBYPTNOYINMRGC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |