C17H30O3 — CID 142609751
2-[2-(3,3-dimethylcyclohexyl)propoxy]ethyl cyclopropanecarboxylate (PubChem CID 142609751) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2-[2-(3,3-dimethylcyclohexyl)propoxy]ethyl cyclopropanecarboxylate.
| Compound Name | 2-[2-(3,3-dimethylcyclohexyl)propoxy]ethyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 142609751 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-[2-(3,3-dimethylcyclohexyl)propoxy]ethyl cyclopropanecarboxylate |
| SMILES | CC(COCCOC(=O)C1CC1)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C17H30O3/c1-13(15-5-4-8-17(2,3)11-15)12-19-9-10-20-16(18)14-6-7-14/h13-15H,4-12H2,1-3H3 |
| InChIKey | CRXKDOQFWDOERZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|