C28H25Br2N3O8 — CID 160649715
3-bromo-2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione;1-bromopyrrolidine-2,5-dione;2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione (PubChem CID 160649715) has the molecular formula C28H25Br2N3O8 and a molecular weight of 691.33 g/mol. Its IUPAC name is 3-bromo-2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione;1-bromopyrrolidine-2,5-dione;2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione.
| Compound Name | 3-bromo-2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione;1-bromopyrrolidine-2,5-dione;2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 160649715 |
| Molecular Formula | C28H25Br2N3O8 |
| Molecular Weight | 691.33 g/mol |
| Exact Mass | 689.00 |
| IUPAC Name | 3-bromo-2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione;1-bromopyrrolidine-2,5-dione;2-(dimethylamino)-5-hydroxynaphthalene-1,4-dione |
| SMILES | CN(C)C1=C(Br)C(=O)c2c(O)cccc2C1=O.CN(C)C1=CC(=O)c2c(O)cccc2C1=O.O=C1CCC(=O)N1Br |
| InChI | InChI=1S/C12H10BrNO3.C12H11NO3.C4H4BrNO2/c1-14(2)10-9(13)12(17)8-6(11(10)16)4-3-5-7(8)15;1-13(2)8-6-10(15)11-7(12(8)16)4-3-5-9(11)14;5-6-3(7)1-2-4(6)8/h3-5,15H,1-2H3;3-6,14H,1-2H3;1-2H2 |
| InChIKey | RKGJVPOUXXPUPF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 152.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|