C16H19FN2O3S — CID 160651782
4-[3-[4-fluoro-2-(hydroxymethyl)phenyl]propylamino]benzenesulfonamide (PubChem CID 160651782) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-[3-[4-fluoro-2-(hydroxymethyl)phenyl]propylamino]benzenesulfonamide.
| Compound Name | 4-[3-[4-fluoro-2-(hydroxymethyl)phenyl]propylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 160651782 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-[3-[4-fluoro-2-(hydroxymethyl)phenyl]propylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCCCc2ccc(F)cc2CO)cc1 |
| InChI | InChI=1S/C16H19FN2O3S/c17-14-4-3-12(13(10-14)11-20)2-1-9-19-15-5-7-16(8-6-15)23(18,21)22/h3-8,10,19-20H,1-2,9,11H2,(H2,18,21,22) |
| InChIKey | RKNDGGMMDMSDRC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|