About formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde
formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde (PubChem CID 160654642) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde |
| PubChem CID | 160654642 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde |
| SMILES | C=O.COc1ccccn1.COc1ncccc1C=O |
| InChI | InChI=1S/C7H7NO2.C6H7NO.CH2O/c1-10-7-6(5-9)3-2-4-8-7;1-8-6-4-2-3-5-7-6;1-2/h2-5H,1H3;2-5H,1H3;1H2 |
| InChIKey | RKWQKWBJNNACPB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde?
The IUPAC name of formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde (CID 160654642) is formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde.
What is the SMILES notation for formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde?
The canonical SMILES for formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde is C=O.COc1ccccn1.COc1ncccc1C=O.
What is the InChIKey of formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde?
The InChIKey is RKWQKWBJNNACPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H7NO.CH2O/c1-10-7-6(5-9)3-2-4-8-7;1-8-6-4-2-3-5-7-6;1-2/h2-5H,1H3;2-5H,1H3;1H2.
What are the key properties of formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde?
formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde has a molecular weight of 276.29 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-methoxypyridine;2-methoxypyridine-3-carbaldehyde is sourced from PubChem (CID 160654642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).