2-methoxypyridine-3-carbaldehyde;phosphoric acid

C7H10NO6P — CID 172754145

IUPAC2-methoxypyridine-3-carbaldehyde;phosphoric acid
SMILESCOc1ncccc1C=O.O=P(O)(O)O
InChIInChI=1S/C7H7NO2.H3O4P/c1-10-7-6(5-9)3-2-4-8-7;1-5(2,3)4/h2-5H,1H3;(H3,1,2,3,4)
InChIKeyKUAZBLOSORBLEB-UHFFFAOYSA-N
MW235.13 g/mol
LogP-0.03
Rot. Bonds2

About 2-methoxypyridine-3-carbaldehyde;phosphoric acid

2-methoxypyridine-3-carbaldehyde;phosphoric acid (PubChem CID 172754145) has the molecular formula C7H10NO6P and a molecular weight of 235.13 g/mol. Its IUPAC name is 2-methoxypyridine-3-carbaldehyde;phosphoric acid.

Molecular Properties

Compound Name2-methoxypyridine-3-carbaldehyde;phosphoric acid
PubChem CID172754145
Molecular FormulaC7H10NO6P
Molecular Weight235.13 g/mol
Exact Mass235.02
IUPAC Name2-methoxypyridine-3-carbaldehyde;phosphoric acid
SMILESCOc1ncccc1C=O.O=P(O)(O)O
InChIInChI=1S/C7H7NO2.H3O4P/c1-10-7-6(5-9)3-2-4-8-7;1-5(2,3)4/h2-5H,1H3;(H3,1,2,3,4)
InChIKeyKUAZBLOSORBLEB-UHFFFAOYSA-N
XLogP-0.03
TPSA116.95 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.13
LogP ≤ 5-0.03
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-methoxypyridine-3-carbaldehyde;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxypyridine-3-carbaldehyde;phosphoric acid?
The IUPAC name of 2-methoxypyridine-3-carbaldehyde;phosphoric acid (CID 172754145) is 2-methoxypyridine-3-carbaldehyde;phosphoric acid.
What is the SMILES notation for 2-methoxypyridine-3-carbaldehyde;phosphoric acid?
The canonical SMILES for 2-methoxypyridine-3-carbaldehyde;phosphoric acid is COc1ncccc1C=O.O=P(O)(O)O.
What is the InChIKey of 2-methoxypyridine-3-carbaldehyde;phosphoric acid?
The InChIKey is KUAZBLOSORBLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.H3O4P/c1-10-7-6(5-9)3-2-4-8-7;1-5(2,3)4/h2-5H,1H3;(H3,1,2,3,4).
What are the key properties of 2-methoxypyridine-3-carbaldehyde;phosphoric acid?
2-methoxypyridine-3-carbaldehyde;phosphoric acid has a molecular weight of 235.13 g/mol, XLogP of -0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypyridine-3-carbaldehyde;phosphoric acid is sourced from PubChem (CID 172754145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).