C20H13N4O+ — CID 160655052
11-phenyl-9-oxa-7,11,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene (PubChem CID 160655052) has the molecular formula C20H13N4O+ and a molecular weight of 325.35 g/mol. Its IUPAC name is 11-phenyl-9-oxa-7,11,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene.
| Compound Name | 11-phenyl-9-oxa-7,11,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
|---|---|
| PubChem CID | 160655052 |
| Molecular Formula | C20H13N4O+ |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 11-phenyl-9-oxa-7,11,15-triaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
| SMILES | c1ccc(-n2c3[n+](c4c5cccnc5oc42)Cc2ccncc2-3)cc1 |
| InChI | InChI=1S/C20H13N4O/c1-2-5-14(6-3-1)24-19-16-11-21-10-8-13(16)12-23(19)17-15-7-4-9-22-18(15)25-20(17)24/h1-11H,12H2/q+1 |
| InChIKey | LEGYYLLONDGYDC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|