C26H18N5+ — CID 161028085
9,11-diphenyl-5,9,11,15-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene (PubChem CID 161028085) has the molecular formula C26H18N5+ and a molecular weight of 400.47 g/mol. Its IUPAC name is 9,11-diphenyl-5,9,11,15-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene.
| Compound Name | 9,11-diphenyl-5,9,11,15-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
|---|---|
| PubChem CID | 161028085 |
| Molecular Formula | C26H18N5+ |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 9,11-diphenyl-5,9,11,15-tetraza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
| SMILES | c1ccc(-n2c3[n+](c4c5cnccc5n(-c5ccccc5)c42)Cc2ccncc2-3)cc1 |
| InChI | InChI=1S/C26H18N5/c1-3-7-19(8-4-1)30-23-12-14-28-16-22(23)24-26(30)31(20-9-5-2-6-10-20)25-21-15-27-13-11-18(21)17-29(24)25/h1-16H,17H2/q+1 |
| InChIKey | FFJOPSILVGAZGA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|