C28H30O6 — CID 160655191
7-(4-hydroxybutoxy)-1H-naphthalen-2-one;4-[(7-oxo-8H-naphthalen-2-yl)oxy]butanal (PubChem CID 160655191) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is 7-(4-hydroxybutoxy)-1H-naphthalen-2-one;4-[(7-oxo-8H-naphthalen-2-yl)oxy]butanal.
| Compound Name | 7-(4-hydroxybutoxy)-1H-naphthalen-2-one;4-[(7-oxo-8H-naphthalen-2-yl)oxy]butanal |
|---|---|
| PubChem CID | 160655191 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 7-(4-hydroxybutoxy)-1H-naphthalen-2-one;4-[(7-oxo-8H-naphthalen-2-yl)oxy]butanal |
| SMILES | O=C1C=Cc2ccc(OCCCCO)cc2C1.O=CCCCOc1ccc2c(c1)CC(=O)C=C2 |
| InChI | InChI=1S/C14H16O3.C14H14O3/c2*15-7-1-2-8-17-14-6-4-11-3-5-13(16)9-12(11)10-14/h3-6,10,15H,1-2,7-9H2;3-7,10H,1-2,8-9H2 |
| InChIKey | RKYIUXRMIDOITN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|