C15H25NO2 — CID 175067623
azane;8-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyloxy)octan-1-ol (PubChem CID 175067623) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is azane;8-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyloxy)octan-1-ol.
| Compound Name | azane;8-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyloxy)octan-1-ol |
|---|---|
| PubChem CID | 175067623 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | azane;8-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyloxy)octan-1-ol |
| SMILES | N.OCCCCCCCCOc1ccc2c(c1)C2 |
| InChI | InChI=1S/C15H22O2.H3N/c16-9-5-3-1-2-4-6-10-17-15-8-7-13-11-14(13)12-15;/h7-8,12,16H,1-6,9-11H2;1H3 |
| InChIKey | OEZHZZWLACHEDL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|