C32H30N10O4 — CID 160656435
N-[(4-oxo-3H-pteridin-2-yl)methyl]-3-phenylpropanamide (PubChem CID 160656435) has the molecular formula C32H30N10O4 and a molecular weight of 618.66 g/mol. Its IUPAC name is N-[(4-oxo-3H-pteridin-2-yl)methyl]-3-phenylpropanamide.
| Compound Name | N-[(4-oxo-3H-pteridin-2-yl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 160656435 |
| Molecular Formula | C32H30N10O4 |
| Molecular Weight | 618.66 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | N-[(4-oxo-3H-pteridin-2-yl)methyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCc1nc2nccnc2c(=O)[nH]1.O=C(CCc1ccccc1)NCc1nc2nccnc2c(=O)[nH]1 |
| InChI | InChI=1S/2C16H15N5O2/c2*22-13(7-6-11-4-2-1-3-5-11)19-10-12-20-15-14(16(23)21-12)17-8-9-18-15/h2*1-5,8-9H,6-7,10H2,(H,19,22)(H,18,20,21,23) |
| InChIKey | RLCKWRSXVHHSHV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 201.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |