About ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one
ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one (PubChem CID 160658385) has the molecular formula C34H59O4+
and a molecular weight of 531.84 g/mol. Its IUPAC name is ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one.
Molecular Properties
| Compound Name | ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one |
| PubChem CID | 160658385 |
| Molecular Formula | C34H59O4+ |
| Molecular Weight | 531.84 g/mol |
| Exact Mass | 531.44 |
| IUPAC Name | ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one |
| SMILES | C=CCCCCCCCCC(=O)OCCCCC=C.O=C1CCCCCCCC/C=C/CCCCO1.[H][C+]=C |
| InChI | InChI=1S/C17H30O2.C15H26O2.C2H3/c1-3-5-7-9-10-11-12-13-15-17(18)19-16-14-8-6-4-2;16-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-17-15;1-2/h3-4H,1-2,5-16H2;4,6H,1-3,5,7-14H2;1H,2H2/q;;+1/b;6-4+; |
| InChIKey | RLIQTGNXNXWTCT-HWWUXOKASA-N |
| XLogP | 10.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.84 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one?
The IUPAC name of ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one (CID 160658385) is ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one.
What is the SMILES notation for ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one?
The canonical SMILES for ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one is C=CCCCCCCCCC(=O)OCCCCC=C.O=C1CCCCCCCC/C=C/CCCCO1.[H][C+]=C.
What is the InChIKey of ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one?
The InChIKey is RLIQTGNXNXWTCT-HWWUXOKASA-N. The full InChI is InChI=1S/C17H30O2.C15H26O2.C2H3/c1-3-5-7-9-10-11-12-13-15-17(18)19-16-14-8-6-4-2;16-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-17-15;1-2/h3-4H,1-2,5-16H2;4,6H,1-3,5,7-14H2;1H,2H2/q;;+1/b;6-4+;.
What are the key properties of ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one?
ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one has a molecular weight of 531.84 g/mol, XLogP of 10.19, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;hex-5-enyl undec-10-enoate;(11E)-1-oxacyclohexadec-11-en-2-one is sourced from PubChem (CID 160658385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).