C24H30N4O — CID 160659542
N-cyclopropyl-1-pentyl-N-(4,5,6,7-tetrahydro-1H-isoindol-5-yl)indazole-4-carboxamide (PubChem CID 160659542) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is N-cyclopropyl-1-pentyl-N-(4,5,6,7-tetrahydro-1H-isoindol-5-yl)indazole-4-carboxamide.
| Compound Name | N-cyclopropyl-1-pentyl-N-(4,5,6,7-tetrahydro-1H-isoindol-5-yl)indazole-4-carboxamide |
|---|---|
| PubChem CID | 160659542 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | N-cyclopropyl-1-pentyl-N-(4,5,6,7-tetrahydro-1H-isoindol-5-yl)indazole-4-carboxamide |
| SMILES | CCCCCn1ncc2c(C(=O)N(C3CC3)C3CCC4=C(C=NC4)C3)cccc21 |
| InChI | InChI=1S/C24H30N4O/c1-2-3-4-12-27-23-7-5-6-21(22(23)16-26-27)24(29)28(19-10-11-19)20-9-8-17-14-25-15-18(17)13-20/h5-7,15-16,19-20H,2-4,8-14H2,1H3 |
| InChIKey | RLMLOGMPGAVOBM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|