About sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate
sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate (PubChem CID 160661140) has the molecular formula C10H18N3NaO2
and a molecular weight of 235.26 g/mol. Its IUPAC name is sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate.
Molecular Properties
| Compound Name | sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate |
| PubChem CID | 160661140 |
| Molecular Formula | C10H18N3NaO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate |
| SMILES | CC(C)Cc1nc(N)cc(=O)[nH]1.CC[O-].[Na+] |
| InChI | InChI=1S/C8H13N3O.C2H5O.Na/c1-5(2)3-7-10-6(9)4-8(12)11-7;1-2-3;/h4-5H,3H2,1-2H3,(H3,9,10,11,12);2H2,1H3;/q;-1;+1 |
| InChIKey | RLROATJGHOQGFI-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate?
The IUPAC name of sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate (CID 160661140) is sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate.
What is the SMILES notation for sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate?
The canonical SMILES for sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate is CC(C)Cc1nc(N)cc(=O)[nH]1.CC[O-].[Na+].
What is the InChIKey of sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate?
The InChIKey is RLROATJGHOQGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O.C2H5O.Na/c1-5(2)3-7-10-6(9)4-8(12)11-7;1-2-3;/h4-5H,3H2,1-2H3,(H3,9,10,11,12);2H2,1H3;/q;-1;+1.
What are the key properties of sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate?
sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate has a molecular weight of 235.26 g/mol, XLogP of -3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-amino-2-(2-methylpropyl)-1H-pyrimidin-6-one;ethanolate is sourced from PubChem (CID 160661140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).