About 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate
2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate (PubChem CID 160665225) has the molecular formula C24H42O2
and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate.
Molecular Properties
| Compound Name | 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate |
| PubChem CID | 160665225 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate |
| SMILES | C=C(C)CCCC(=C)CCC.C=C(C)CCCC(=C)CCOC(=O)CC |
| InChI | InChI=1S/C13H22O2.C11H20/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3;1-5-7-11(4)9-6-8-10(2)3/h2,4-10H2,1,3H3;2,4-9H2,1,3H3 |
| InChIKey | RMEYRUXASPJFIJ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate?
The IUPAC name of 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate (CID 160665225) is 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate.
What is the SMILES notation for 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate?
The canonical SMILES for 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate is C=C(C)CCCC(=C)CCC.C=C(C)CCCC(=C)CCOC(=O)CC.
What is the InChIKey of 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate?
The InChIKey is RMEYRUXASPJFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2.C11H20/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3;1-5-7-11(4)9-6-8-10(2)3/h2,4-10H2,1,3H3;2,4-9H2,1,3H3.
What are the key properties of 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate?
2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate has a molecular weight of 362.60 g/mol, XLogP of 7.72, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-methylidenenon-1-ene;(7-methyl-3-methylideneoct-7-enyl) propanoate is sourced from PubChem (CID 160665225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).