C27H25N5O7 — CID 160671563
4-(4-methyl-3-nitrophenoxy)pyridin-2-amine;1-[4-(4-methyl-3-nitrophenoxy)-2-pyridinyl]propan-2-one (PubChem CID 160671563) has the molecular formula C27H25N5O7 and a molecular weight of 531.53 g/mol. Its IUPAC name is 4-(4-methyl-3-nitrophenoxy)pyridin-2-amine;1-[4-(4-methyl-3-nitrophenoxy)-2-pyridinyl]propan-2-one.
| Compound Name | 4-(4-methyl-3-nitrophenoxy)pyridin-2-amine;1-[4-(4-methyl-3-nitrophenoxy)-2-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 160671563 |
| Molecular Formula | C27H25N5O7 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 4-(4-methyl-3-nitrophenoxy)pyridin-2-amine;1-[4-(4-methyl-3-nitrophenoxy)-2-pyridinyl]propan-2-one |
| SMILES | CC(=O)Cc1cc(Oc2ccc(C)c([N+](=O)[O-])c2)ccn1.Cc1ccc(Oc2ccnc(N)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N2O4.C12H11N3O3/c1-10-3-4-13(9-15(10)17(19)20)21-14-5-6-16-12(8-14)7-11(2)18;1-8-2-3-9(6-11(8)15(16)17)18-10-4-5-14-12(13)7-10/h3-6,8-9H,7H2,1-2H3;2-7H,1H3,(H2,13,14) |
| InChIKey | RMZLHVUMKHTAQQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 173.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|