C15H14ClN3O4 — CID 158043851
1-chloro-3-[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]propan-2-one (PubChem CID 158043851) has the molecular formula C15H14ClN3O4 and a molecular weight of 335.75 g/mol. Its IUPAC name is 1-chloro-3-[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]propan-2-one.
| Compound Name | 1-chloro-3-[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 158043851 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-chloro-3-[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]propan-2-one |
| SMILES | CNc1ccc(Oc2ccnc(CC(=O)CCl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14ClN3O4/c1-17-14-3-2-12(8-15(14)19(21)22)23-13-4-5-18-10(7-13)6-11(20)9-16/h2-5,7-8,17H,6,9H2,1H3 |
| InChIKey | CJTWEQFWCFUXHD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|