C17H16F3NO3 — CID 158763587
1-methoxy-3-[4-[4-methyl-3-(trifluoromethyl)phenoxy]-2-pyridinyl]propan-2-one (PubChem CID 158763587) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is 1-methoxy-3-[4-[4-methyl-3-(trifluoromethyl)phenoxy]-2-pyridinyl]propan-2-one.
| Compound Name | 1-methoxy-3-[4-[4-methyl-3-(trifluoromethyl)phenoxy]-2-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 158763587 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-methoxy-3-[4-[4-methyl-3-(trifluoromethyl)phenoxy]-2-pyridinyl]propan-2-one |
| SMILES | COCC(=O)Cc1cc(Oc2ccc(C)c(C(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C17H16F3NO3/c1-11-3-4-14(9-16(11)17(18,19)20)24-15-5-6-21-12(8-15)7-13(22)10-23-2/h3-6,8-9H,7,10H2,1-2H3 |
| InChIKey | NTOXKWMEOFUIPV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |