C30H32N6O9 — CID 160916912
tert-butyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylate;[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]methanol (PubChem CID 160916912) has the molecular formula C30H32N6O9 and a molecular weight of 620.62 g/mol. Its IUPAC name is tert-butyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylate;[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]methanol.
| Compound Name | tert-butyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylate;[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 160916912 |
| Molecular Formula | C30H32N6O9 |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | tert-butyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylate;[4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinyl]methanol |
| SMILES | CNc1ccc(Oc2ccnc(C(=O)OC(C)(C)C)c2)cc1[N+](=O)[O-].CNc1ccc(Oc2ccnc(CO)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N3O5.C13H13N3O4/c1-17(2,3)25-16(21)14-9-12(7-8-19-14)24-11-5-6-13(18-4)15(10-11)20(22)23;1-14-12-3-2-10(7-13(12)16(18)19)20-11-4-5-15-9(6-11)8-17/h5-10,18H,1-4H3;2-7,14,17H,8H2,1H3 |
| InChIKey | SRNDUBZPTKSVJO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|