C25H24N4O — CID 160675066
(2-methyl-3-pyridinyl)-[6-[(3S)-3-phenylpiperazin-1-yl]-3-prop-1-ynyl-2-pyridinyl]methanone (PubChem CID 160675066) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is (2-methyl-3-pyridinyl)-[6-[(3S)-3-phenylpiperazin-1-yl]-3-prop-1-ynyl-2-pyridinyl]methanone.
| Compound Name | (2-methyl-3-pyridinyl)-[6-[(3S)-3-phenylpiperazin-1-yl]-3-prop-1-ynyl-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 160675066 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2-methyl-3-pyridinyl)-[6-[(3S)-3-phenylpiperazin-1-yl]-3-prop-1-ynyl-2-pyridinyl]methanone |
| SMILES | CC#Cc1ccc(N2CCN[C@@H](c3ccccc3)C2)nc1C(=O)c1cccnc1C |
| InChI | InChI=1S/C25H24N4O/c1-3-8-20-12-13-23(28-24(20)25(30)21-11-7-14-26-18(21)2)29-16-15-27-22(17-29)19-9-5-4-6-10-19/h4-7,9-14,22,27H,15-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | QCQGFKUWENVQBD-JOCHJYFZSA-N |
| XLogP | 3.54 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|