C12H21NO — CID 160676471
4,5-ditert-butyl-2,4-dihydropyrrol-3-one (PubChem CID 160676471) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 4,5-ditert-butyl-2,4-dihydropyrrol-3-one.
| Compound Name | 4,5-ditert-butyl-2,4-dihydropyrrol-3-one |
|---|---|
| PubChem CID | 160676471 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4,5-ditert-butyl-2,4-dihydropyrrol-3-one |
| SMILES | CC(C)(C)C1=NCC(=O)C1C(C)(C)C |
| InChI | InChI=1S/C12H21NO/c1-11(2,3)9-8(14)7-13-10(9)12(4,5)6/h9H,7H2,1-6H3 |
| InChIKey | CYMXWOLAEGGBHH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |