C21H39NO2Y-2 — CID 148791418
1-(butan-2-ylideneamino)pentan-2-one;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium (PubChem CID 148791418) has the molecular formula C21H39NO2Y-2 and a molecular weight of 426.45 g/mol. Its IUPAC name is 1-(butan-2-ylideneamino)pentan-2-one;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium.
| Compound Name | 1-(butan-2-ylideneamino)pentan-2-one;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium |
|---|---|
| PubChem CID | 148791418 |
| Molecular Formula | C21H39NO2Y-2 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-(butan-2-ylideneamino)pentan-2-one;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium |
| SMILES | [CH2-]C(CC(C)(C)C)C(=O)C(C)(C)C.[CH2-]C/C(C)=N/CC(=O)CCC.[Y] |
| InChI | InChI=1S/C12H23O.C9H16NO.Y/c1-9(8-11(2,3)4)10(13)12(5,6)7;1-4-6-9(11)7-10-8(3)5-2;/h9H,1,8H2,2-7H3;2,4-7H2,1,3H3;/q2*-1;/b;10-8+; |
| InChIKey | GMNXUFDLOAROGZ-PWPIVAAGSA-N |
| XLogP | 5.53 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|