C16H29NO — CID 123556728
5-(2-ethylhexylimino)-3,3-dimethylcyclohexan-1-one (PubChem CID 123556728) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 5-(2-ethylhexylimino)-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-(2-ethylhexylimino)-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 123556728 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 5-(2-ethylhexylimino)-3,3-dimethylcyclohexan-1-one |
| SMILES | CCCCC(CC)C/N=C1\CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C16H29NO/c1-5-7-8-13(6-2)12-17-14-9-15(18)11-16(3,4)10-14/h13H,5-12H2,1-4H3/b17-14+ |
| InChIKey | GDTMMPVPOCAIJL-SAPNQHFASA-N |
| XLogP | 4.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|