C12H21NO — CID 163842109
2-tert-butyl-4-ethyl-4,5-dimethyl-2H-pyrrol-3-one (PubChem CID 163842109) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-tert-butyl-4-ethyl-4,5-dimethyl-2H-pyrrol-3-one.
| Compound Name | 2-tert-butyl-4-ethyl-4,5-dimethyl-2H-pyrrol-3-one |
|---|---|
| PubChem CID | 163842109 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-tert-butyl-4-ethyl-4,5-dimethyl-2H-pyrrol-3-one |
| SMILES | CCC1(C)C(=O)C(C(C)(C)C)N=C1C |
| InChI | InChI=1S/C12H21NO/c1-7-12(6)8(2)13-9(10(12)14)11(3,4)5/h9H,7H2,1-6H3 |
| InChIKey | OMXDRRBRPKPRJP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |