C14H27NO — CID 71356048
2,2,6,6-tetramethyl-5-propyliminoheptan-3-one (PubChem CID 71356048) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-5-propyliminoheptan-3-one.
| Compound Name | 2,2,6,6-tetramethyl-5-propyliminoheptan-3-one |
|---|---|
| PubChem CID | 71356048 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2,2,6,6-tetramethyl-5-propyliminoheptan-3-one |
| SMILES | CCC/N=C(\CC(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H27NO/c1-8-9-15-11(13(2,3)4)10-12(16)14(5,6)7/h8-10H2,1-7H3/b15-11+ |
| InChIKey | KBITWCHHQNYEAS-RVDMUPIBSA-N |
| XLogP | 3.89 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|