C19H35NO2 — CID 123470993
4-(C-ethyl-N-nonylcarbonimidoyl)heptane-3,5-dione (PubChem CID 123470993) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is 4-(C-ethyl-N-nonylcarbonimidoyl)heptane-3,5-dione.
| Compound Name | 4-(C-ethyl-N-nonylcarbonimidoyl)heptane-3,5-dione |
|---|---|
| PubChem CID | 123470993 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | 4-(C-ethyl-N-nonylcarbonimidoyl)heptane-3,5-dione |
| SMILES | CCCCCCCCC/N=C(\CC)C(C(=O)CC)C(=O)CC |
| InChI | InChI=1S/C19H35NO2/c1-5-9-10-11-12-13-14-15-20-16(6-2)19(17(21)7-3)18(22)8-4/h19H,5-15H2,1-4H3/b20-16+ |
| InChIKey | OLGMAZMRXGOHAZ-CAPFRKAQSA-N |
| XLogP | 5.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|