C10H17NO — CID 83963280
1-(3,4-dihydro-2H-pyrrol-5-yl)-2-ethylbutan-1-one (PubChem CID 83963280) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyrrol-5-yl)-2-ethylbutan-1-one.
| Compound Name | 1-(3,4-dihydro-2H-pyrrol-5-yl)-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 83963280 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyrrol-5-yl)-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)C1=NCCC1 |
| InChI | InChI=1S/C10H17NO/c1-3-8(4-2)10(12)9-6-5-7-11-9/h8H,3-7H2,1-2H3 |
| InChIKey | KXMYPGKTPVPROW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |