C19H33NO2 — CID 90825335
7-tert-butyl-1-(3,4-dihydro-2H-pyrrol-5-yl)-2-methyldecane-1,8-dione (PubChem CID 90825335) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 7-tert-butyl-1-(3,4-dihydro-2H-pyrrol-5-yl)-2-methyldecane-1,8-dione.
| Compound Name | 7-tert-butyl-1-(3,4-dihydro-2H-pyrrol-5-yl)-2-methyldecane-1,8-dione |
|---|---|
| PubChem CID | 90825335 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 7-tert-butyl-1-(3,4-dihydro-2H-pyrrol-5-yl)-2-methyldecane-1,8-dione |
| SMILES | CCC(=O)C(CCCCC(C)C(=O)C1=NCCC1)C(C)(C)C |
| InChI | InChI=1S/C19H33NO2/c1-6-17(21)15(19(3,4)5)11-8-7-10-14(2)18(22)16-12-9-13-20-16/h14-15H,6-13H2,1-5H3 |
| InChIKey | IHZGHGUJEHIWSB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|