C13H19NO2 — CID 134901569
(3aR,7aS)-3-(2,2-dimethylpropanoyl)-1,3a,5,6,7,7a-hexahydroisoindol-4-one (PubChem CID 134901569) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3aR,7aS)-3-(2,2-dimethylpropanoyl)-1,3a,5,6,7,7a-hexahydroisoindol-4-one.
| Compound Name | (3aR,7aS)-3-(2,2-dimethylpropanoyl)-1,3a,5,6,7,7a-hexahydroisoindol-4-one |
|---|---|
| PubChem CID | 134901569 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3aR,7aS)-3-(2,2-dimethylpropanoyl)-1,3a,5,6,7,7a-hexahydroisoindol-4-one |
| SMILES | CC(C)(C)C(=O)C1=NC[C@H]2CCCC(=O)[C@@H]12 |
| InChI | InChI=1S/C13H19NO2/c1-13(2,3)12(16)11-10-8(7-14-11)5-4-6-9(10)15/h8,10H,4-7H2,1-3H3/t8-,10+/m1/s1 |
| InChIKey | KRPNKDRTADQNPZ-SCZZXKLOSA-N |
| XLogP | 2.04 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |