C10H13NO — CID 134988684
(2aR,8aS)-2a,3,5,6,7,8-hexahydro-2H-cyclobuta[c]indol-1-one (PubChem CID 134988684) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (2aR,8aS)-2a,3,5,6,7,8-hexahydro-2H-cyclobuta[c]indol-1-one.
| Compound Name | (2aR,8aS)-2a,3,5,6,7,8-hexahydro-2H-cyclobuta[c]indol-1-one |
|---|---|
| PubChem CID | 134988684 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2aR,8aS)-2a,3,5,6,7,8-hexahydro-2H-cyclobuta[c]indol-1-one |
| SMILES | O=C1C[C@H]2CN=C3CCCC[C@@]132 |
| InChI | InChI=1S/C10H13NO/c12-9-5-7-6-11-8-3-1-2-4-10(7,8)9/h7H,1-6H2/t7-,10-/m0/s1 |
| InChIKey | XICLKLBPYFOXFR-XVKPBYJWSA-N |
| XLogP | 1.59 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |