C9H13NO — CID 10725527
3a-methyl-3,4,6,7-tetrahydro-2H-indol-5-one (PubChem CID 10725527) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3a-methyl-3,4,6,7-tetrahydro-2H-indol-5-one.
| Compound Name | 3a-methyl-3,4,6,7-tetrahydro-2H-indol-5-one |
|---|---|
| PubChem CID | 10725527 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3a-methyl-3,4,6,7-tetrahydro-2H-indol-5-one |
| SMILES | CC12CCN=C1CCC(=O)C2 |
| InChI | InChI=1S/C9H13NO/c1-9-4-5-10-8(9)3-2-7(11)6-9/h2-6H2,1H3 |
| InChIKey | HRZRWMCMBHKPGB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |