C11H17NO — CID 135075822
1-[(3aR,4R)-3,3a,4,5,6,7-hexahydro-2H-indol-4-yl]propan-2-one (PubChem CID 135075822) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-[(3aR,4R)-3,3a,4,5,6,7-hexahydro-2H-indol-4-yl]propan-2-one.
| Compound Name | 1-[(3aR,4R)-3,3a,4,5,6,7-hexahydro-2H-indol-4-yl]propan-2-one |
|---|---|
| PubChem CID | 135075822 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-[(3aR,4R)-3,3a,4,5,6,7-hexahydro-2H-indol-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1CCCC2=NCC[C@@H]21 |
| InChI | InChI=1S/C11H17NO/c1-8(13)7-9-3-2-4-11-10(9)5-6-12-11/h9-10H,2-7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | JOWPNOQRWCODHZ-NXEZZACHSA-N |
| XLogP | 2.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |