C20H42N2O4 — CID 160683825
5-methyl-2-(propan-2-ylamino)hexanoic acid;5-methyl-3-(propan-2-ylamino)hexanoic acid (PubChem CID 160683825) has the molecular formula C20H42N2O4 and a molecular weight of 374.57 g/mol. Its IUPAC name is 5-methyl-2-(propan-2-ylamino)hexanoic acid;5-methyl-3-(propan-2-ylamino)hexanoic acid.
| Compound Name | 5-methyl-2-(propan-2-ylamino)hexanoic acid;5-methyl-3-(propan-2-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 160683825 |
| Molecular Formula | C20H42N2O4 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | 5-methyl-2-(propan-2-ylamino)hexanoic acid;5-methyl-3-(propan-2-ylamino)hexanoic acid |
| SMILES | CC(C)CC(CC(=O)O)NC(C)C.CC(C)CCC(NC(C)C)C(=O)O |
| InChI | InChI=1S/2C10H21NO2/c1-7(2)5-9(6-10(12)13)11-8(3)4;1-7(2)5-6-9(10(12)13)11-8(3)4/h2*7-9,11H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | ROMNPSGQFOMZEQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |