C24H36N2O11 — CID 160688660
7-[[9-carboxy-4-formyl-9-(methylamino)-6-oxononanoyl]amino]-4-oxo-2-(3-oxobutyl)octanedioic acid (PubChem CID 160688660) has the molecular formula C24H36N2O11 and a molecular weight of 528.56 g/mol. Its IUPAC name is 7-[[9-carboxy-4-formyl-9-(methylamino)-6-oxononanoyl]amino]-4-oxo-2-(3-oxobutyl)octanedioic acid.
| Compound Name | 7-[[9-carboxy-4-formyl-9-(methylamino)-6-oxononanoyl]amino]-4-oxo-2-(3-oxobutyl)octanedioic acid |
|---|---|
| PubChem CID | 160688660 |
| Molecular Formula | C24H36N2O11 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 7-[[9-carboxy-4-formyl-9-(methylamino)-6-oxononanoyl]amino]-4-oxo-2-(3-oxobutyl)octanedioic acid |
| SMILES | CNC(CCC(=O)CC(C=O)CCC(=O)NC(CCC(=O)CC(CCC(C)=O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H36N2O11/c1-14(28)3-5-16(22(32)33)12-18(30)7-9-20(24(36)37)26-21(31)10-4-15(13-27)11-17(29)6-8-19(25-2)23(34)35/h13,15-16,19-20,25H,3-12H2,1-2H3,(H,26,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | CHMWHYGJASJVGB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 221.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|