C27H26ClN5O7 — CID 16069304
Betrixaban maleate (PubChem CID 16069304) has the molecular formula C27H26ClN5O7 and a molecular weight of 568.00 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-methoxybenzamide.
| Compound Name | Betrixaban maleate |
|---|---|
| PubChem CID | 16069304 |
| Molecular Formula | C27H26ClN5O7 |
| Molecular Weight | 568.00 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-methoxybenzamide |
| SMILES | CN(C)C(=N)C1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)OC)C(=O)NC3=NC=C(C=C3)Cl.C(=C\C(=O)O)\C(=O)O |
| InChI | InChI=1S/C23H22ClN5O3.C4H4O4/c1-29(2)21(25)14-4-6-15(7-5-14)22(30)27-19-10-9-17(32-3)12-18(19)23(31)28-20-11-8-16(24)13-26-20;5-3(6)1-2-4(7)8/h4-13,25H,1-3H3,(H,27,30)(H,26,28,31);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DTSJEZCXVWQKCL-BTJKTKAUSA-N |
| XLogP | — |
| TPSA | 182.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | 787 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|