About 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine
5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine (PubChem CID 160698295) has the molecular formula C15H19BrN4O2
and a molecular weight of 367.25 g/mol. Its IUPAC name is 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine.
Molecular Properties
| Compound Name | 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine |
| PubChem CID | 160698295 |
| Molecular Formula | C15H19BrN4O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine |
| SMILES | Brc1ccc(C2CC2)nc1.CCOC=O.Nc1cncnc1 |
| InChI | InChI=1S/C8H8BrN.C4H5N3.C3H6O2/c9-7-3-4-8(10-5-7)6-1-2-6;5-4-1-6-3-7-2-4;1-2-5-3-4/h3-6H,1-2H2;1-3H,5H2;3H,2H2,1H3 |
| InChIKey | RQGWUECGEALLLH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine?
The IUPAC name of 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine (CID 160698295) is 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine.
What is the SMILES notation for 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine?
The canonical SMILES for 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine is Brc1ccc(C2CC2)nc1.CCOC=O.Nc1cncnc1.
What is the InChIKey of 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine?
The InChIKey is RQGWUECGEALLLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN.C4H5N3.C3H6O2/c9-7-3-4-8(10-5-7)6-1-2-6;5-4-1-6-3-7-2-4;1-2-5-3-4/h3-6H,1-2H2;1-3H,5H2;3H,2H2,1H3.
What are the key properties of 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine?
5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine has a molecular weight of 367.25 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-cyclopropylpyridine;ethyl formate;pyrimidin-5-amine is sourced from PubChem (CID 160698295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).