C27H29NO3S — CID 160700648
2-naphthalen-2-yl-1-[(1R)-2-[4-(piperidin-4-ylmethylsulfonyl)phenyl]cyclopropyl]ethanone (PubChem CID 160700648) has the molecular formula C27H29NO3S and a molecular weight of 447.60 g/mol. Its IUPAC name is 2-naphthalen-2-yl-1-[(1R)-2-[4-(piperidin-4-ylmethylsulfonyl)phenyl]cyclopropyl]ethanone.
| Compound Name | 2-naphthalen-2-yl-1-[(1R)-2-[4-(piperidin-4-ylmethylsulfonyl)phenyl]cyclopropyl]ethanone |
|---|---|
| PubChem CID | 160700648 |
| Molecular Formula | C27H29NO3S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-naphthalen-2-yl-1-[(1R)-2-[4-(piperidin-4-ylmethylsulfonyl)phenyl]cyclopropyl]ethanone |
| SMILES | O=C(Cc1ccc2ccccc2c1)[C@@H]1CC1c1ccc(S(=O)(=O)CC2CCNCC2)cc1 |
| InChI | InChI=1S/C27H29NO3S/c29-27(16-20-5-6-21-3-1-2-4-23(21)15-20)26-17-25(26)22-7-9-24(10-8-22)32(30,31)18-19-11-13-28-14-12-19/h1-10,15,19,25-26,28H,11-14,16-18H2/t25?,26-/m1/s1 |
| InChIKey | JMYXDBADBSSSKA-FXDYGKIASA-N |
| XLogP | 4.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |