C15H14F2N2O3S — CID 160701153
3-(3,4-difluorophenyl)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 160701153) has the molecular formula C15H14F2N2O3S and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 160701153 |
| Molecular Formula | C15H14F2N2O3S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H14F2N2O3S/c16-13-7-1-10(9-14(13)17)2-8-15(20)19-11-3-5-12(6-4-11)23(18,21)22/h1,3-7,9H,2,8H2,(H,19,20)(H2,18,21,22) |
| InChIKey | RQQBITVLULUAEW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |