About 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine
2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine (PubChem CID 160701527) has the molecular formula C14H25N3O3
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine |
| PubChem CID | 160701527 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine |
| SMILES | CC#CC(=O)OC.CCCN.CCn1[nH]c(C)cc1=O |
| InChI | InChI=1S/C6H10N2O.C5H6O2.C3H9N/c1-3-8-6(9)4-5(2)7-8;1-3-4-5(6)7-2;1-2-3-4/h4,7H,3H2,1-2H3;1-2H3;2-4H2,1H3 |
| InChIKey | KTRYIMYDLPSEDO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine?
The IUPAC name of 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine (CID 160701527) is 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine.
What is the SMILES notation for 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine?
The canonical SMILES for 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine is CC#CC(=O)OC.CCCN.CCn1[nH]c(C)cc1=O.
What is the InChIKey of 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine?
The InChIKey is KTRYIMYDLPSEDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.C5H6O2.C3H9N/c1-3-8-6(9)4-5(2)7-8;1-3-4-5(6)7-2;1-2-3-4/h4,7H,3H2,1-2H3;1-2H3;2-4H2,1H3.
What are the key properties of 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine?
2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine has a molecular weight of 283.37 g/mol, XLogP of 1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-1H-pyrazol-3-one;methyl but-2-ynoate;propan-1-amine is sourced from PubChem (CID 160701527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).