C30H32O8 — CID 160701879
2,3-dimethoxy-5-phenylbenzene-1,4-diol;2-(3,4-dimethoxyphenyl)-1,4-dimethoxybenzene (PubChem CID 160701879) has the molecular formula C30H32O8 and a molecular weight of 520.58 g/mol. Its IUPAC name is 2,3-dimethoxy-5-phenylbenzene-1,4-diol;2-(3,4-dimethoxyphenyl)-1,4-dimethoxybenzene.
| Compound Name | 2,3-dimethoxy-5-phenylbenzene-1,4-diol;2-(3,4-dimethoxyphenyl)-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 160701879 |
| Molecular Formula | C30H32O8 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 2,3-dimethoxy-5-phenylbenzene-1,4-diol;2-(3,4-dimethoxyphenyl)-1,4-dimethoxybenzene |
| SMILES | COc1c(O)cc(-c2ccccc2)c(O)c1OC.COc1ccc(OC)c(-c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C16H18O4.C14H14O4/c1-17-12-6-8-14(18-2)13(10-12)11-5-7-15(19-3)16(9-11)20-4;1-17-13-11(15)8-10(12(16)14(13)18-2)9-6-4-3-5-7-9/h5-10H,1-4H3;3-8,15-16H,1-2H3 |
| InChIKey | RQSLRTMZECPDJQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|