C30H36N2O3 — CID 160702689
2-[4-[[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]methyl]phenoxy]-N-ethylethanamine (PubChem CID 160702689) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[4-[[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]methyl]phenoxy]-N-ethylethanamine.
| Compound Name | 2-[4-[[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]methyl]phenoxy]-N-ethylethanamine |
|---|---|
| PubChem CID | 160702689 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 2-[4-[[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]methyl]phenoxy]-N-ethylethanamine |
| SMILES | CCNCCOc1ccc(Cc2ccc3[nH]c(-c4ccc(OC)c(OC)c4)c(C(C)C)c3c2)cc1 |
| InChI | InChI=1S/C30H36N2O3/c1-6-31-15-16-35-24-11-7-21(8-12-24)17-22-9-13-26-25(18-22)29(20(2)3)30(32-26)23-10-14-27(33-4)28(19-23)34-5/h7-14,18-20,31-32H,6,15-17H2,1-5H3 |
| InChIKey | RQUZZZYJEJIAEY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|