C33H24N2O3 — CID 160707197
4-(2-methylpropoxy)-N-(3-phenyl-1,2-oxazol-5-yl)benzamide;trideca-1,2,3,4,5,6,7,8,9,10,11,12-dodecaene (PubChem CID 160707197) has the molecular formula C33H24N2O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is 4-(2-methylpropoxy)-N-(3-phenyl-1,2-oxazol-5-yl)benzamide;trideca-1,2,3,4,5,6,7,8,9,10,11,12-dodecaene.
| Compound Name | 4-(2-methylpropoxy)-N-(3-phenyl-1,2-oxazol-5-yl)benzamide;trideca-1,2,3,4,5,6,7,8,9,10,11,12-dodecaene |
|---|---|
| PubChem CID | 160707197 |
| Molecular Formula | C33H24N2O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-(2-methylpropoxy)-N-(3-phenyl-1,2-oxazol-5-yl)benzamide;trideca-1,2,3,4,5,6,7,8,9,10,11,12-dodecaene |
| SMILES | C=C=C=C=C=C=C=C=C=C=C=C=C.CC(C)COc1ccc(C(=O)Nc2cc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C20H20N2O3.C13H4/c1-14(2)13-24-17-10-8-16(9-11-17)20(23)21-19-12-18(22-25-19)15-6-4-3-5-7-15;1-3-5-7-9-11-13-12-10-8-6-4-2/h3-12,14H,13H2,1-2H3,(H,21,23);1-2H2 |
| InChIKey | RRJNWZBECAYEJB-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |