C48H34F8N6O2 — CID 160707602
1-(4-fluorophenyl)-5-[2-(trifluoromethyl)oxiran-2-yl]indazole;1H-indole;1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-indol-1-ylpropan-2-ol (PubChem CID 160707602) has the molecular formula C48H34F8N6O2 and a molecular weight of 878.82 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[2-(trifluoromethyl)oxiran-2-yl]indazole;1H-indole;1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-indol-1-ylpropan-2-ol.
| Compound Name | 1-(4-fluorophenyl)-5-[2-(trifluoromethyl)oxiran-2-yl]indazole;1H-indole;1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-indol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 160707602 |
| Molecular Formula | C48H34F8N6O2 |
| Molecular Weight | 878.82 g/mol |
| Exact Mass | 878.26 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[2-(trifluoromethyl)oxiran-2-yl]indazole;1H-indole;1,1,1-trifluoro-2-[1-(4-fluorophenyl)indazol-5-yl]-3-indol-1-ylpropan-2-ol |
| SMILES | Fc1ccc(-n2ncc3cc(C4(C(F)(F)F)CO4)ccc32)cc1.OC(Cn1ccc2ccccc21)(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(F)(F)F.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C24H17F4N3O.C16H10F4N2O.C8H7N/c25-19-6-8-20(9-7-19)31-22-10-5-18(13-17(22)14-29-31)23(32,24(26,27)28)15-30-12-11-16-3-1-2-4-21(16)30;17-12-2-4-13(5-3-12)22-14-6-1-11(7-10(14)8-21-22)15(9-23-15)16(18,19)20;1-2-4-8-7(3-1)5-6-9-8/h1-14,32H,15H2;1-8H,9H2;1-6,9H |
| InChIKey | RRKUJTWYNUDFAY-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.82 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|