About 1-bromo-4-fluoro-2-methylbenzene;difluoromethane
1-bromo-4-fluoro-2-methylbenzene;difluoromethane (PubChem CID 160708102) has the molecular formula C8H8BrF3
and a molecular weight of 241.05 g/mol. Its IUPAC name is 1-bromo-4-fluoro-2-methylbenzene;difluoromethane.
Molecular Properties
| Compound Name | 1-bromo-4-fluoro-2-methylbenzene;difluoromethane |
| PubChem CID | 160708102 |
| Molecular Formula | C8H8BrF3 |
| Molecular Weight | 241.05 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 1-bromo-4-fluoro-2-methylbenzene;difluoromethane |
| SMILES | Cc1cc(F)ccc1Br.FCF |
| InChI | InChI=1S/C7H6BrF.CH2F2/c1-5-4-6(9)2-3-7(5)8;2-1-3/h2-4H,1H3;1H2 |
| InChIKey | RRMNBSGOMDSWMB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.05 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-4-fluoro-2-methylbenzene;difluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-fluoro-2-methylbenzene;difluoromethane?
The IUPAC name of 1-bromo-4-fluoro-2-methylbenzene;difluoromethane (CID 160708102) is 1-bromo-4-fluoro-2-methylbenzene;difluoromethane.
What is the SMILES notation for 1-bromo-4-fluoro-2-methylbenzene;difluoromethane?
The canonical SMILES for 1-bromo-4-fluoro-2-methylbenzene;difluoromethane is Cc1cc(F)ccc1Br.FCF.
What is the InChIKey of 1-bromo-4-fluoro-2-methylbenzene;difluoromethane?
The InChIKey is RRMNBSGOMDSWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrF.CH2F2/c1-5-4-6(9)2-3-7(5)8;2-1-3/h2-4H,1H3;1H2.
What are the key properties of 1-bromo-4-fluoro-2-methylbenzene;difluoromethane?
1-bromo-4-fluoro-2-methylbenzene;difluoromethane has a molecular weight of 241.05 g/mol, XLogP of 3.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-fluoro-2-methylbenzene;difluoromethane is sourced from PubChem (CID 160708102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).