C17H16BrF — CID 159320278
2-bromo-6-fluoro-3-methylanthracene;ethane (PubChem CID 159320278) has the molecular formula C17H16BrF and a molecular weight of 319.22 g/mol. Its IUPAC name is 2-bromo-6-fluoro-3-methylanthracene;ethane.
| Compound Name | 2-bromo-6-fluoro-3-methylanthracene;ethane |
|---|---|
| PubChem CID | 159320278 |
| Molecular Formula | C17H16BrF |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-bromo-6-fluoro-3-methylanthracene;ethane |
| SMILES | CC.Cc1cc2cc3cc(F)ccc3cc2cc1Br |
| InChI | InChI=1S/C15H10BrF.C2H6/c1-9-4-11-6-12-7-14(17)3-2-10(12)5-13(11)8-15(9)16;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | LDRCSGNFPDTHND-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|