About 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline
2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline (PubChem CID 142152830) has the molecular formula C16H21BrFN
and a molecular weight of 326.25 g/mol. Its IUPAC name is 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline.
Molecular Properties
| Compound Name | 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline |
| PubChem CID | 142152830 |
| Molecular Formula | C16H21BrFN |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline |
| SMILES | CC.Cc1ccc(F)cc1Br.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C7H6BrF.C7H9N.C2H6/c1-5-2-3-6(9)4-7(5)8;1-6-2-4-7(8)5-3-6;1-2/h2-4H,1H3;2-5H,8H2,1H3;1-2H3 |
| InChIKey | MVGVOMAYJBMFSQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline?
The IUPAC name of 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline (CID 142152830) is 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline.
What is the SMILES notation for 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline?
The canonical SMILES for 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline is CC.Cc1ccc(F)cc1Br.Cc1ccc(N)cc1.
What is the InChIKey of 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline?
The InChIKey is MVGVOMAYJBMFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrF.C7H9N.C2H6/c1-5-2-3-6(9)4-7(5)8;1-6-2-4-7(8)5-3-6;1-2/h2-4H,1H3;2-5H,8H2,1H3;1-2H3.
What are the key properties of 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline?
2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline has a molecular weight of 326.25 g/mol, XLogP of 5.50, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-fluoro-1-methylbenzene;ethane;4-methylaniline is sourced from PubChem (CID 142152830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).