C13H13Br3N2 — CID 67732885
4-methylaniline;2,4,6-tribromoaniline (PubChem CID 67732885) has the molecular formula C13H13Br3N2 and a molecular weight of 436.97 g/mol. Its IUPAC name is 4-methylaniline;2,4,6-tribromoaniline.
| Compound Name | 4-methylaniline;2,4,6-tribromoaniline |
|---|---|
| PubChem CID | 67732885 |
| Molecular Formula | C13H13Br3N2 |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 433.86 |
| IUPAC Name | 4-methylaniline;2,4,6-tribromoaniline |
| SMILES | Cc1ccc(N)cc1.Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C7H9N.C6H4Br3N/c1-6-2-4-7(8)5-3-6;7-3-1-4(8)6(10)5(9)2-3/h2-5H,8H2,1H3;1-2H,10H2 |
| InChIKey | QVZGZTCHVBEYSB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|