C13H22ClNO2 — CID 160709108
octa-1,3,5-trien-3-yl N,N-diethylcarbamate;hydrochloride (PubChem CID 160709108) has the molecular formula C13H22ClNO2 and a molecular weight of 259.78 g/mol. Its IUPAC name is octa-1,3,5-trien-3-yl N,N-diethylcarbamate;hydrochloride.
| Compound Name | octa-1,3,5-trien-3-yl N,N-diethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 160709108 |
| Molecular Formula | C13H22ClNO2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | octa-1,3,5-trien-3-yl N,N-diethylcarbamate;hydrochloride |
| SMILES | C=CC(=CC=CCC)OC(=O)N(CC)CC.Cl |
| InChI | InChI=1S/C13H21NO2.ClH/c1-5-9-10-11-12(6-2)16-13(15)14(7-3)8-4;/h6,9-11H,2,5,7-8H2,1,3-4H3;1H |
| InChIKey | RRPQQUUTPNOYLP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|