C41H43BBr3N5O6 — CID 160710827
2,4-dibromoquinoline;methyl 3-[(4-bromoquinolin-2-yl)amino]propanoate;methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate (PubChem CID 160710827) has the molecular formula C41H43BBr3N5O6 and a molecular weight of 952.35 g/mol. Its IUPAC name is 2,4-dibromoquinoline;methyl 3-[(4-bromoquinolin-2-yl)amino]propanoate;methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate.
| Compound Name | 2,4-dibromoquinoline;methyl 3-[(4-bromoquinolin-2-yl)amino]propanoate;methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 160710827 |
| Molecular Formula | C41H43BBr3N5O6 |
| Molecular Weight | 952.35 g/mol |
| Exact Mass | 949.09 |
| IUPAC Name | 2,4-dibromoquinoline;methyl 3-[(4-bromoquinolin-2-yl)amino]propanoate;methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate |
| SMILES | Brc1cc(Br)c2ccccc2n1.COC(=O)CCNc1cc(B2OC(C)(C)C(C)(C)O2)c2ccccc2n1.COC(=O)CCNc1cc(Br)c2ccccc2n1 |
| InChI | InChI=1S/C19H25BN2O4.C13H13BrN2O2.C9H5Br2N/c1-18(2)19(3,4)26-20(25-18)14-12-16(21-11-10-17(23)24-5)22-15-9-7-6-8-13(14)15;1-18-13(17)6-7-15-12-8-10(14)9-4-2-3-5-11(9)16-12;10-7-5-9(11)12-8-4-2-1-3-6(7)8/h6-9,12H,10-11H2,1-5H3,(H,21,22);2-5,8H,6-7H2,1H3,(H,15,16);1-5H |
| InChIKey | RRVJCBJNWWDQIM-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.35 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|