C17H37NO3 — CID 160711041
ethane;methane;3-methyl-N-[2-(5-methyl-4-oxohexoxy)ethyl]butanamide (PubChem CID 160711041) has the molecular formula C17H37NO3 and a molecular weight of 303.49 g/mol. Its IUPAC name is ethane;methane;3-methyl-N-[2-(5-methyl-4-oxohexoxy)ethyl]butanamide.
| Compound Name | ethane;methane;3-methyl-N-[2-(5-methyl-4-oxohexoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 160711041 |
| Molecular Formula | C17H37NO3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.28 |
| IUPAC Name | ethane;methane;3-methyl-N-[2-(5-methyl-4-oxohexoxy)ethyl]butanamide |
| SMILES | C.CC.CC(C)CC(=O)NCCOCCCC(=O)C(C)C |
| InChI | InChI=1S/C14H27NO3.C2H6.CH4/c1-11(2)10-14(17)15-7-9-18-8-5-6-13(16)12(3)4;1-2;/h11-12H,5-10H2,1-4H3,(H,15,17);1-2H3;1H4 |
| InChIKey | RRWAQJGOASWASL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|